C16H25NO4 — CID 101455324
(4S,5S)-6,6-dimethoxy-5-(4-methoxyanilino)-4-methylhexan-3-one (PubChem CID 101455324) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is (4S,5S)-6,6-dimethoxy-5-(4-methoxyanilino)-4-methylhexan-3-one.
| Compound Name | (4S,5S)-6,6-dimethoxy-5-(4-methoxyanilino)-4-methylhexan-3-one |
|---|---|
| PubChem CID | 101455324 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (4S,5S)-6,6-dimethoxy-5-(4-methoxyanilino)-4-methylhexan-3-one |
| SMILES | CCC(=O)[C@@H](C)[C@H](Nc1ccc(OC)cc1)C(OC)OC |
| InChI | InChI=1S/C16H25NO4/c1-6-14(18)11(2)15(16(20-4)21-5)17-12-7-9-13(19-3)10-8-12/h7-11,15-17H,6H2,1-5H3/t11-,15+/m1/s1 |
| InChIKey | YJBSMLVCCCKDJW-ABAIWWIYSA-N |
| XLogP | 2.71 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|