C25H29N3O4 — CID 122384106
tert-butyl (2S,3S)-2-(4-methoxyanilino)-4-(1-methylimidazol-2-yl)-4-oxo-3-phenylbutanoate (PubChem CID 122384106) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-(4-methoxyanilino)-4-(1-methylimidazol-2-yl)-4-oxo-3-phenylbutanoate.
| Compound Name | tert-butyl (2S,3S)-2-(4-methoxyanilino)-4-(1-methylimidazol-2-yl)-4-oxo-3-phenylbutanoate |
|---|---|
| PubChem CID | 122384106 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | tert-butyl (2S,3S)-2-(4-methoxyanilino)-4-(1-methylimidazol-2-yl)-4-oxo-3-phenylbutanoate |
| SMILES | COc1ccc(N[C@H](C(=O)OC(C)(C)C)[C@@H](C(=O)c2nccn2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-25(2,3)32-24(30)21(27-18-11-13-19(31-5)14-12-18)20(17-9-7-6-8-10-17)22(29)23-26-15-16-28(23)4/h6-16,20-21,27H,1-5H3/t20-,21-/m0/s1 |
| InChIKey | SFVJBOABBPQLEK-SFTDATJTSA-N |
| XLogP | 4.22 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|