C23H34INO3 — CID 123275431
7-hydroxy-N-[(3S,4S)-1-iodo-3,5-dimethyl-7-phenylmethoxyhepta-1,5-dien-4-yl]heptanamide (PubChem CID 123275431) has the molecular formula C23H34INO3 and a molecular weight of 499.43 g/mol. Its IUPAC name is 7-hydroxy-N-[(3S,4S)-1-iodo-3,5-dimethyl-7-phenylmethoxyhepta-1,5-dien-4-yl]heptanamide.
| Compound Name | 7-hydroxy-N-[(3S,4S)-1-iodo-3,5-dimethyl-7-phenylmethoxyhepta-1,5-dien-4-yl]heptanamide |
|---|---|
| PubChem CID | 123275431 |
| Molecular Formula | C23H34INO3 |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 7-hydroxy-N-[(3S,4S)-1-iodo-3,5-dimethyl-7-phenylmethoxyhepta-1,5-dien-4-yl]heptanamide |
| SMILES | CC(=CCOCc1ccccc1)[C@@H](NC(=O)CCCCCCO)[C@@H](C)C=CI |
| InChI | InChI=1S/C23H34INO3/c1-19(13-15-24)23(25-22(27)12-8-3-4-9-16-26)20(2)14-17-28-18-21-10-6-5-7-11-21/h5-7,10-11,13-15,19,23,26H,3-4,8-9,12,16-18H2,1-2H3,(H,25,27)/t19-,23-/m0/s1 |
| InChIKey | ZIBMPLSWYCBZBS-CVDCTZTESA-N |
| XLogP | 5.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|