C24H37N3O7 — CID 46930349
(2S)-3-hydroxy-2-[[(2S)-3-methyl-2-[8-(phenylmethoxycarbonylamino)octanoylamino]butanoyl]amino]propanoic acid (PubChem CID 46930349) has the molecular formula C24H37N3O7 and a molecular weight of 479.57 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[[(2S)-3-methyl-2-[8-(phenylmethoxycarbonylamino)octanoylamino]butanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-[[(2S)-3-methyl-2-[8-(phenylmethoxycarbonylamino)octanoylamino]butanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 46930349 |
| Molecular Formula | C24H37N3O7 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (2S)-3-hydroxy-2-[[(2S)-3-methyl-2-[8-(phenylmethoxycarbonylamino)octanoylamino]butanoyl]amino]propanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCCCCCNC(=O)OCc1ccccc1)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C24H37N3O7/c1-17(2)21(22(30)26-19(15-28)23(31)32)27-20(29)13-9-4-3-5-10-14-25-24(33)34-16-18-11-7-6-8-12-18/h6-8,11-12,17,19,21,28H,3-5,9-10,13-16H2,1-2H3,(H,25,33)(H,26,30)(H,27,29)(H,31,32)/t19-,21-/m0/s1 |
| InChIKey | YLRLHSKDGFYEGT-FPOVZHCZSA-N |
| XLogP | 1.96 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|