C24H32N2O4S — CID 101001603
(E,2R,5S)-N,2-dimethyl-6-phenylmethoxy-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-3-enamide (PubChem CID 101001603) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is (E,2R,5S)-N,2-dimethyl-6-phenylmethoxy-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-3-enamide.
| Compound Name | (E,2R,5S)-N,2-dimethyl-6-phenylmethoxy-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-3-enamide |
|---|---|
| PubChem CID | 101001603 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (E,2R,5S)-N,2-dimethyl-6-phenylmethoxy-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-3-enamide |
| SMILES | CNC(=O)[C@H](C)/C=C/[C@@H](COCc1ccccc1)NS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H32N2O4S/c1-17-13-19(3)23(20(4)14-17)31(28,29)26-22(12-11-18(2)24(27)25-5)16-30-15-21-9-7-6-8-10-21/h6-14,18,22,26H,15-16H2,1-5H3,(H,25,27)/b12-11+/t18-,22+/m1/s1 |
| InChIKey | OVEAOABPKUKOHK-RUUIYCEZSA-N |
| XLogP | 3.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|