C28H39NO4S — CID 10791085
tert-butyl (E,2S,5S)-6-phenyl-2-propan-2-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-3-enoate (PubChem CID 10791085) has the molecular formula C28H39NO4S and a molecular weight of 485.69 g/mol. Its IUPAC name is tert-butyl (E,2S,5S)-6-phenyl-2-propan-2-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-3-enoate.
| Compound Name | tert-butyl (E,2S,5S)-6-phenyl-2-propan-2-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-3-enoate |
|---|---|
| PubChem CID | 10791085 |
| Molecular Formula | C28H39NO4S |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | tert-butyl (E,2S,5S)-6-phenyl-2-propan-2-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]hex-3-enoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@H](/C=C/[C@@H](C(=O)OC(C)(C)C)C(C)C)Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H39NO4S/c1-19(2)25(27(30)33-28(6,7)8)15-14-24(18-23-12-10-9-11-13-23)29-34(31,32)26-21(4)16-20(3)17-22(26)5/h9-17,19,24-25,29H,18H2,1-8H3/b15-14+/t24-,25-/m1/s1 |
| InChIKey | GLZGSSIOUXCKCR-LJAHQNNKSA-N |
| XLogP | 5.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|