C16H22O7 — CID 70186106
2-(2,2-dihydroxyethoxy)ethane-1,1-diol;phenol (PubChem CID 70186106) has the molecular formula C16H22O7 and a molecular weight of 326.34 g/mol. Its IUPAC name is 2-(2,2-dihydroxyethoxy)ethane-1,1-diol;phenol.
| Compound Name | 2-(2,2-dihydroxyethoxy)ethane-1,1-diol;phenol |
|---|---|
| PubChem CID | 70186106 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-(2,2-dihydroxyethoxy)ethane-1,1-diol;phenol |
| SMILES | OC(O)COCC(O)O.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/2C6H6O.C4H10O5/c2*7-6-4-2-1-3-5-6;5-3(6)1-9-2-4(7)8/h2*1-5,7H;3-8H,1-2H2 |
| InChIKey | GODJJUROYPFYNF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|