C26H26N4O5S — CID 3901025
N-[3-benzylsulfanyl-1-[2-[(3-methoxy-4-methylphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-4-nitrobenzamide (PubChem CID 3901025) has the molecular formula C26H26N4O5S and a molecular weight of 506.58 g/mol. Its IUPAC name is N-[3-benzylsulfanyl-1-[2-[(3-methoxy-4-methylphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-4-nitrobenzamide.
| Compound Name | N-[3-benzylsulfanyl-1-[2-[(3-methoxy-4-methylphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3901025 |
| Molecular Formula | C26H26N4O5S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | N-[3-benzylsulfanyl-1-[2-[(3-methoxy-4-methylphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-4-nitrobenzamide |
| SMILES | COc1cc(C=NNC(=O)C(CSCc2ccccc2)NC(=O)c2ccc([N+](=O)[O-])cc2)ccc1C |
| InChI | InChI=1S/C26H26N4O5S/c1-18-8-9-20(14-24(18)35-2)15-27-29-26(32)23(17-36-16-19-6-4-3-5-7-19)28-25(31)21-10-12-22(13-11-21)30(33)34/h3-15,23H,16-17H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | QOSNBZXXEWGYPU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|