C28H23N5O7S — CID 4127728
N-[3-benzylsulfanyl-1-[2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-3,5-dinitrobenzamide (PubChem CID 4127728) has the molecular formula C28H23N5O7S and a molecular weight of 573.59 g/mol. Its IUPAC name is N-[3-benzylsulfanyl-1-[2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[3-benzylsulfanyl-1-[2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4127728 |
| Molecular Formula | C28H23N5O7S |
| Molecular Weight | 573.59 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | N-[3-benzylsulfanyl-1-[2-[(2-hydroxynaphthalen-1-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]-3,5-dinitrobenzamide |
| SMILES | O=C(NC(CSCc1ccccc1)C(=O)NN=Cc1c(O)ccc2ccccc12)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H23N5O7S/c34-26-11-10-19-8-4-5-9-23(19)24(26)15-29-31-28(36)25(17-41-16-18-6-2-1-3-7-18)30-27(35)20-12-21(32(37)38)14-22(13-20)33(39)40/h1-15,25,34H,16-17H2,(H,30,35)(H,31,36) |
| InChIKey | UUJHQNIGAGKLTL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 177.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|