C18H18N4O6 — CID 4913816
benzyl N-[3-hydroxy-1-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 4913816) has the molecular formula C18H18N4O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is benzyl N-[3-hydroxy-1-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[3-hydroxy-1-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 4913816 |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | benzyl N-[3-hydroxy-1-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | O=C(NC(CO)C(=O)NN=Cc1ccc([N+](=O)[O-])cc1)OCc1ccccc1 |
| InChI | InChI=1S/C18H18N4O6/c23-11-16(20-18(25)28-12-14-4-2-1-3-5-14)17(24)21-19-10-13-6-8-15(9-7-13)22(26)27/h1-10,16,23H,11-12H2,(H,20,25)(H,21,24) |
| InChIKey | GMPWKYQGZHOMBM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|