C19H20FN3O4 — CID 8022971
benzyl N-[(2R,3R)-1-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-3-hydroxy-1-oxobutan-2-yl]carbamate (PubChem CID 8022971) has the molecular formula C19H20FN3O4 and a molecular weight of 373.38 g/mol. Its IUPAC name is benzyl N-[(2R,3R)-1-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-3-hydroxy-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R,3R)-1-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-3-hydroxy-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 8022971 |
| Molecular Formula | C19H20FN3O4 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | benzyl N-[(2R,3R)-1-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-3-hydroxy-1-oxobutan-2-yl]carbamate |
| SMILES | C[C@@H](O)[C@@H](NC(=O)OCc1ccccc1)C(=O)N/N=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O4/c1-13(24)17(22-19(26)27-12-15-5-3-2-4-6-15)18(25)23-21-11-14-7-9-16(20)10-8-14/h2-11,13,17,24H,12H2,1H3,(H,22,26)(H,23,25)/b21-11-/t13-,17-/m1/s1 |
| InChIKey | UKRITCXKHZUBSA-IQLVASAKSA-N |
| XLogP | 1.95 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|