C21H21N5O3 — CID 126000547
benzyl N-[(2R)-1-[(2Z)-2-benzylidenehydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 126000547) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[(2Z)-2-benzylidenehydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-[(2Z)-2-benzylidenehydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126000547 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | benzyl N-[(2R)-1-[(2Z)-2-benzylidenehydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | O=C(N[C@H](Cc1cnc[nH]1)C(=O)N/N=C\c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H21N5O3/c27-20(26-24-12-16-7-3-1-4-8-16)19(11-18-13-22-15-23-18)25-21(28)29-14-17-9-5-2-6-10-17/h1-10,12-13,15,19H,11,14H2,(H,22,23)(H,25,28)(H,26,27)/b24-12-/t19-/m1/s1 |
| InChIKey | XNGAZYDVOIHYGO-HRGKPLJHSA-N |
| XLogP | 2.40 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|