C21H20BrN5O4 — CID 137036116
benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 137036116) has the molecular formula C21H20BrN5O4 and a molecular weight of 486.33 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 137036116 |
| Molecular Formula | C21H20BrN5O4 |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1cnc[nH]1)C(=O)N/N=C\c1cc(Br)ccc1O)OCc1ccccc1 |
| InChI | InChI=1S/C21H20BrN5O4/c22-16-6-7-19(28)15(8-16)10-25-27-20(29)18(9-17-11-23-13-24-17)26-21(30)31-12-14-4-2-1-3-5-14/h1-8,10-11,13,18,28H,9,12H2,(H,23,24)(H,26,30)(H,27,29)/b25-10-/t18-/m0/s1 |
| InChIKey | SYDVAAINWUUPHN-BDPZTQBQSA-N |
| XLogP | 2.87 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|