C22H22BrN5O5 — CID 137120656
benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 137120656) has the molecular formula C22H22BrN5O5 and a molecular weight of 516.35 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 137120656 |
| Molecular Formula | C22H22BrN5O5 |
| Molecular Weight | 516.35 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1cc(Br)cc(/C=N\NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)OCc2ccccc2)c1O |
| InChI | InChI=1S/C22H22BrN5O5/c1-32-19-8-16(23)7-15(20(19)29)10-26-28-21(30)18(9-17-11-24-13-25-17)27-22(31)33-12-14-5-3-2-4-6-14/h2-8,10-11,13,18,29H,9,12H2,1H3,(H,24,25)(H,27,31)(H,28,30)/b26-10-/t18-/m0/s1 |
| InChIKey | CLBDNRNMIIBRJS-UBYAVARKSA-N |
| XLogP | 2.87 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|