C24H24N6O3 — CID 137035708
benzyl N-[(2R)-3-(1H-imidazol-5-yl)-1-[(2Z)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 137035708) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is benzyl N-[(2R)-3-(1H-imidazol-5-yl)-1-[(2Z)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-3-(1H-imidazol-5-yl)-1-[(2Z)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 137035708 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | benzyl N-[(2R)-3-(1H-imidazol-5-yl)-1-[(2Z)-2-[(2-methyl-1H-indol-3-yl)methylidene]hydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1[nH]c2ccccc2c1/C=N\NC(=O)[C@@H](Cc1cnc[nH]1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H24N6O3/c1-16-20(19-9-5-6-10-21(19)28-16)13-27-30-23(31)22(11-18-12-25-15-26-18)29-24(32)33-14-17-7-3-2-4-8-17/h2-10,12-13,15,22,28H,11,14H2,1H3,(H,25,26)(H,29,32)(H,30,31)/b27-13-/t22-/m1/s1 |
| InChIKey | ASRWKYGVRJRFED-QNDNQQOJSA-N |
| XLogP | 3.19 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|