C28H30N6O5 — CID 126009154
ethyl 2-[3-[(Z)-[[(2S)-3-(1H-imidazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate (PubChem CID 126009154) has the molecular formula C28H30N6O5 and a molecular weight of 530.59 g/mol. Its IUPAC name is ethyl 2-[3-[(Z)-[[(2S)-3-(1H-imidazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[(Z)-[[(2S)-3-(1H-imidazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 126009154 |
| Molecular Formula | C28H30N6O5 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | ethyl 2-[3-[(Z)-[[(2S)-3-(1H-imidazol-5-yl)-2-(phenylmethoxycarbonylamino)propanoyl]hydrazinylidene]methyl]-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(/C=N\NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H30N6O5/c1-3-38-26(35)16-34-19(2)23(22-11-7-8-12-25(22)34)15-31-33-27(36)24(13-21-14-29-18-30-21)32-28(37)39-17-20-9-5-4-6-10-20/h4-12,14-15,18,24H,3,13,16-17H2,1-2H3,(H,29,30)(H,32,37)(H,33,36)/b31-15-/t24-/m0/s1 |
| InChIKey | OMKMBYJVKYJHIH-COXVRVBQSA-N |
| XLogP | 3.22 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|