C30H30ClN5O5 — CID 126000594
benzyl N-[(2S)-1-[(2Z)-2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 126000594) has the molecular formula C30H30ClN5O5 and a molecular weight of 576.05 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2Z)-2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2Z)-2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126000594 |
| Molecular Formula | C30H30ClN5O5 |
| Molecular Weight | 576.05 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | benzyl N-[(2S)-1-[(2Z)-2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)OCc2ccccc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H30ClN5O5/c1-2-39-28-14-23(10-13-27(28)40-18-22-8-11-24(31)12-9-22)16-34-36-29(37)26(15-25-17-32-20-33-25)35-30(38)41-19-21-6-4-3-5-7-21/h3-14,16-17,20,26H,2,15,18-19H2,1H3,(H,32,33)(H,35,38)(H,36,37)/b34-16-/t26-/m0/s1 |
| InChIKey | XSFFMLLYKIXXFF-VSUZZSPFSA-N |
| XLogP | 5.03 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.05 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|