C30H29N5O7 — CID 126004792
benzyl N-[(2S)-1-[(2Z)-2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 126004792) has the molecular formula C30H29N5O7 and a molecular weight of 571.59 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2Z)-2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2Z)-2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126004792 |
| Molecular Formula | C30H29N5O7 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | benzyl N-[(2S)-1-[(2Z)-2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-methoxyphenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1cc(/C=N\NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)OCc2ccccc2)ccc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H29N5O7/c1-38-27-11-21(7-9-25(27)39-17-22-8-10-26-28(12-22)42-19-41-26)14-33-35-29(36)24(13-23-15-31-18-32-23)34-30(37)40-16-20-5-3-2-4-6-20/h2-12,14-15,18,24H,13,16-17,19H2,1H3,(H,31,32)(H,34,37)(H,35,36)/b33-14-/t24-/m0/s1 |
| InChIKey | AMDKHNJGKPCEST-IZPSPQCISA-N |
| XLogP | 3.71 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|