C29H26N6O4 — CID 26478454
benzyl N-[(2S)-1-[(2Z)-2-[[4-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 26478454) has the molecular formula C29H26N6O4 and a molecular weight of 522.57 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2Z)-2-[[4-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2Z)-2-[[4-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 26478454 |
| Molecular Formula | C29H26N6O4 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | benzyl N-[(2S)-1-[(2Z)-2-[[4-[(2-cyanophenyl)methoxy]phenyl]methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | N#Cc1ccccc1COc1ccc(/C=N\NC(=O)[C@H](Cc2cnc[nH]2)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N6O4/c30-15-23-8-4-5-9-24(23)19-38-26-12-10-21(11-13-26)16-33-35-28(36)27(14-25-17-31-20-32-25)34-29(37)39-18-22-6-2-1-3-7-22/h1-13,16-17,20,27H,14,18-19H2,(H,31,32)(H,34,37)(H,35,36)/b33-16-/t27-/m0/s1 |
| InChIKey | YKVTWPUOUDOMIN-UZYUKORZSA-N |
| XLogP | 3.85 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|