C22H22ClN5O4 — CID 126000976
benzyl N-[(2S)-1-[(2Z)-2-[(5-chloro-2-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 126000976) has the molecular formula C22H22ClN5O4 and a molecular weight of 455.90 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2Z)-2-[(5-chloro-2-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2Z)-2-[(5-chloro-2-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126000976 |
| Molecular Formula | C22H22ClN5O4 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | benzyl N-[(2S)-1-[(2Z)-2-[(5-chloro-2-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(Cl)cc1/C=N\NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22ClN5O4/c1-31-20-8-7-17(23)9-16(20)11-26-28-21(29)19(10-18-12-24-14-25-18)27-22(30)32-13-15-5-3-2-4-6-15/h2-9,11-12,14,19H,10,13H2,1H3,(H,24,25)(H,27,30)(H,28,29)/b26-11-/t19-/m0/s1 |
| InChIKey | YSRAFRKZPZOFHL-CEXQZHQISA-N |
| XLogP | 3.06 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|