C27H25BrN4O5 — CID 137071903
benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 137071903) has the molecular formula C27H25BrN4O5 and a molecular weight of 565.42 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 137071903 |
| Molecular Formula | C27H25BrN4O5 |
| Molecular Weight | 565.42 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | benzyl N-[(2S)-1-[(2Z)-2-[(5-bromo-2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1cc(Br)cc(/C=N\NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)OCc2ccccc2)c1O |
| InChI | InChI=1S/C27H25BrN4O5/c1-36-24-13-20(28)11-19(25(24)33)15-30-32-26(34)23(12-18-14-29-22-10-6-5-9-21(18)22)31-27(35)37-16-17-7-3-2-4-8-17/h2-11,13-15,23,29,33H,12,16H2,1H3,(H,31,35)(H,32,34)/b30-15-/t23-/m0/s1 |
| InChIKey | OAYSYQZJVQPINV-NRFCLKMUSA-N |
| XLogP | 4.63 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|