C24H23Cl3N2O2 — CID 19060330
N-[(E)-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine (PubChem CID 19060330) has the molecular formula C24H23Cl3N2O2 and a molecular weight of 477.82 g/mol. Its IUPAC name is N-[(E)-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine.
| Compound Name | N-[(E)-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 19060330 |
| Molecular Formula | C24H23Cl3N2O2 |
| Molecular Weight | 477.82 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | N-[(E)-[3-chloro-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-1-(2,6-dichlorophenyl)methanamine |
| SMILES | CCOc1cc(/C=N/NCc2c(Cl)cccc2Cl)cc(Cl)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H23Cl3N2O2/c1-3-30-23-12-18(13-28-29-14-19-20(25)5-4-6-21(19)26)11-22(27)24(23)31-15-17-9-7-16(2)8-10-17/h4-13,29H,3,14-15H2,1-2H3/b28-13+ |
| InChIKey | CNHNPSYAWPSZPS-XODNFHPESA-N |
| XLogP | 7.06 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.82 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|