C15H12ClFN2O2S — CID 53488647
methyl 4-[(3-chloro-2-fluorophenyl)carbamothioylamino]benzoate (PubChem CID 53488647) has the molecular formula C15H12ClFN2O2S and a molecular weight of 338.79 g/mol. Its IUPAC name is methyl 4-[(3-chloro-2-fluorophenyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-[(3-chloro-2-fluorophenyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 53488647 |
| Molecular Formula | C15H12ClFN2O2S |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | methyl 4-[(3-chloro-2-fluorophenyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)Nc2cccc(Cl)c2F)cc1 |
| InChI | InChI=1S/C15H12ClFN2O2S/c1-21-14(20)9-5-7-10(8-6-9)18-15(22)19-12-4-2-3-11(16)13(12)17/h2-8H,1H3,(H2,18,19,22) |
| InChIKey | HEMYFRVQRWDCIT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|