C16H14BrN3O2S — CID 1270917
methyl 3-[[(4-bromophenyl)methylideneamino]carbamothioylamino]benzoate (PubChem CID 1270917) has the molecular formula C16H14BrN3O2S and a molecular weight of 392.28 g/mol. Its IUPAC name is methyl 3-[[(4-bromophenyl)methylideneamino]carbamothioylamino]benzoate.
| Compound Name | methyl 3-[[(4-bromophenyl)methylideneamino]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 1270917 |
| Molecular Formula | C16H14BrN3O2S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | methyl 3-[[(4-bromophenyl)methylideneamino]carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NN=Cc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C16H14BrN3O2S/c1-22-15(21)12-3-2-4-14(9-12)19-16(23)20-18-10-11-5-7-13(17)8-6-11/h2-10H,1H3,(H2,19,20,23) |
| InChIKey | NUSBROYBLZGBOW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|