C24H25ClN6O2 — CID 6218365
N-[(Z)-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide (PubChem CID 6218365) has the molecular formula C24H25ClN6O2 and a molecular weight of 464.96 g/mol. Its IUPAC name is N-[(Z)-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide.
| Compound Name | N-[(Z)-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 6218365 |
| Molecular Formula | C24H25ClN6O2 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-[(Z)-[5-chloro-1-[(3-methoxyphenyl)methyl]-3-methylpyrazol-4-yl]methylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)N/N=C\c3c(C)nn(Cc4cccc(OC)c4)c3Cl)ccc21 |
| InChI | InChI=1S/C24H25ClN6O2/c1-5-30-16(3)27-21-12-18(9-10-22(21)30)24(32)28-26-13-20-15(2)29-31(23(20)25)14-17-7-6-8-19(11-17)33-4/h6-13H,5,14H2,1-4H3,(H,28,32)/b26-13- |
| InChIKey | YVQLVEXZPNHTSI-ZMFRSBBQSA-N |
| XLogP | 4.34 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|