C22H19FN4O2 — CID 2121499
1-ethyl-N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-methylbenzimidazole-5-carboxamide (PubChem CID 2121499) has the molecular formula C22H19FN4O2 and a molecular weight of 390.42 g/mol. Its IUPAC name is 1-ethyl-N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-methylbenzimidazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 2121499 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-ethyl-N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-methylbenzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)NN=Cc3ccc(-c4ccc(F)cc4)o3)ccc21 |
| InChI | InChI=1S/C22H19FN4O2/c1-3-27-14(2)25-19-12-16(6-10-20(19)27)22(28)26-24-13-18-9-11-21(29-18)15-4-7-17(23)8-5-15/h4-13H,3H2,1-2H3,(H,26,28) |
| InChIKey | JVXXPWMXVIFSEL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|