C16H12N6S3 — CID 9295279
4-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione (PubChem CID 9295279) has the molecular formula C16H12N6S3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 4-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 9295279 |
| Molecular Formula | C16H12N6S3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 4-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1,2,4-triazolidine-3,5-dithione |
| SMILES | S=c1[nH][nH]c(=S)n1/N=C\c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C16H12N6S3/c23-15-18-19-16(24)22(15)17-9-11-10-21(12-5-2-1-3-6-12)20-14(11)13-7-4-8-25-13/h1-10H,(H,18,23)(H,19,24)/b17-9- |
| InChIKey | FMTXKJGNTPJEOH-MFOYZWKCSA-N |
| XLogP | 4.40 |
| TPSA | 66.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|