C19H16N6S2 — CID 9295694
4-[(Z)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,2,4-triazolidine-3,5-dithione (PubChem CID 9295694) has the molecular formula C19H16N6S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 4-[(Z)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-[(Z)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 9295694 |
| Molecular Formula | C19H16N6S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-[(Z)-[3-(3-methylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,2,4-triazolidine-3,5-dithione |
| SMILES | Cc1cccc(-c2nn(-c3ccccc3)cc2/C=N\n2c(=S)[nH][nH]c2=S)c1 |
| InChI | InChI=1S/C19H16N6S2/c1-13-6-5-7-14(10-13)17-15(11-20-25-18(26)21-22-19(25)27)12-24(23-17)16-8-3-2-4-9-16/h2-12H,1H3,(H,21,26)(H,22,27)/b20-11- |
| InChIKey | RCGVBGSAHUDKGP-JAIQZWGSSA-N |
| XLogP | 4.65 |
| TPSA | 66.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|