C24H23N5O — CID 9025080
6-amino-1-[(Z)-[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylpyridin-2-one (PubChem CID 9025080) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 6-amino-1-[(Z)-[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylpyridin-2-one.
| Compound Name | 6-amino-1-[(Z)-[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 9025080 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 6-amino-1-[(Z)-[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylpyridin-2-one |
| SMILES | Cc1cc(N)n(/N=C\c2cn(-c3ccccc3)nc2-c2ccc(C)c(C)c2)c(=O)c1 |
| InChI | InChI=1S/C24H23N5O/c1-16-11-22(25)29(23(30)12-16)26-14-20-15-28(21-7-5-4-6-8-21)27-24(20)19-10-9-17(2)18(3)13-19/h4-15H,25H2,1-3H3/b26-14- |
| InChIKey | JEYCBDNWENZNNV-WGARJPEWSA-N |
| XLogP | 4.09 |
| TPSA | 78.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|