C21H19N5O2 — CID 9351336
1-[(Z)-[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 9351336) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-[(Z)-[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 1-[(Z)-[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9351336 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[(Z)-[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=N\N2CC(=O)NC2=O)cc1C |
| InChI | InChI=1S/C21H19N5O2/c1-14-8-9-16(10-15(14)2)20-17(11-22-26-13-19(27)23-21(26)28)12-25(24-20)18-6-4-3-5-7-18/h3-12H,13H2,1-2H3,(H,23,27,28)/b22-11- |
| InChIKey | YGHCTLGZWQXTTK-JJFYIABZSA-N |
| XLogP | 3.04 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|