C19H14ClN5O2 — CID 9351055
1-[(Z)-[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione (PubChem CID 9351055) has the molecular formula C19H14ClN5O2 and a molecular weight of 379.81 g/mol. Its IUPAC name is 1-[(Z)-[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione.
| Compound Name | 1-[(Z)-[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9351055 |
| Molecular Formula | C19H14ClN5O2 |
| Molecular Weight | 379.81 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-[(Z)-[3-(3-chlorophenyl)-1-phenylpyrazol-4-yl]methylideneamino]imidazolidine-2,4-dione |
| SMILES | O=C1CN(/N=C\c2cn(-c3ccccc3)nc2-c2cccc(Cl)c2)C(=O)N1 |
| InChI | InChI=1S/C19H14ClN5O2/c20-15-6-4-5-13(9-15)18-14(10-21-25-12-17(26)22-19(25)27)11-24(23-18)16-7-2-1-3-8-16/h1-11H,12H2,(H,22,26,27)/b21-10- |
| InChIKey | DUBOIJKMXQLFCU-FBHDLOMBSA-N |
| XLogP | 3.08 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.81 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|