C25H18F2N6OS — CID 3582553
3-[4-(difluoromethoxy)phenyl]-4-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 3582553) has the molecular formula C25H18F2N6OS and a molecular weight of 488.52 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-4-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-4-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3582553 |
| Molecular Formula | C25H18F2N6OS |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-4-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)Oc1ccc(-c2n[nH]c(=S)n2N=Cc2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H18F2N6OS/c26-24(27)34-21-13-11-18(12-14-21)23-29-30-25(35)33(23)28-15-19-16-32(20-9-5-2-6-10-20)31-22(19)17-7-3-1-4-8-17/h1-16,24H,(H,30,35) |
| InChIKey | BIGOIRUEJIGOOD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|