C23H18F2N4O2S — CID 3584640
3-[4-(difluoromethoxy)phenyl]-4-[(3-phenylmethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 3584640) has the molecular formula C23H18F2N4O2S and a molecular weight of 452.49 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-4-[(3-phenylmethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-4-[(3-phenylmethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 3584640 |
| Molecular Formula | C23H18F2N4O2S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-4-[(3-phenylmethoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)Oc1ccc(-c2n[nH]c(=S)n2N=Cc2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H18F2N4O2S/c24-22(25)31-19-11-9-18(10-12-19)21-27-28-23(32)29(21)26-14-17-7-4-8-20(13-17)30-15-16-5-2-1-3-6-16/h1-14,22H,15H2,(H,28,32) |
| InChIKey | IJSRMCORCLRCML-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 64.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|