C19H18F2N4O3S — CID 135606325
3-[4-(difluoromethoxy)phenyl]-4-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 135606325) has the molecular formula C19H18F2N4O3S and a molecular weight of 420.44 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-4-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-4-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135606325 |
| Molecular Formula | C19H18F2N4O3S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-4-[(E)-(2-hydroxy-4-propoxyphenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCCOc1ccc(/C=N/n2c(-c3ccc(OC(F)F)cc3)n[nH]c2=S)c(O)c1 |
| InChI | InChI=1S/C19H18F2N4O3S/c1-2-9-27-15-8-5-13(16(26)10-15)11-22-25-17(23-24-19(25)29)12-3-6-14(7-4-12)28-18(20)21/h3-8,10-11,18,26H,2,9H2,1H3,(H,24,29)/b22-11+ |
| InChIKey | PHETWCFPHJCGPI-SSDVNMTOSA-N |
| XLogP | 4.59 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|