C23H16F2N6OS2 — CID 4642501
3-[4-(difluoromethoxy)phenyl]-4-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 4642501) has the molecular formula C23H16F2N6OS2 and a molecular weight of 494.55 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-4-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-4-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4642501 |
| Molecular Formula | C23H16F2N6OS2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-4-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)Oc1ccc(-c2n[nH]c(=S)n2N=Cc2cn(-c3ccccc3)nc2-c2cccs2)cc1 |
| InChI | InChI=1S/C23H16F2N6OS2/c24-22(25)32-18-10-8-15(9-11-18)21-27-28-23(33)31(21)26-13-16-14-30(17-5-2-1-3-6-17)29-20(16)19-7-4-12-34-19/h1-14,22H,(H,28,33) |
| InChIKey | YVWCOLCBGLFPLQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|