C21H15N7OS — CID 8980197
3-(furan-2-yl)-4-[(Z)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 8980197) has the molecular formula C21H15N7OS and a molecular weight of 413.47 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-[(Z)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(furan-2-yl)-4-[(Z)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 8980197 |
| Molecular Formula | C21H15N7OS |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 3-(furan-2-yl)-4-[(Z)-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccco2)n1/N=C\c1cn(-c2ccccc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C21H15N7OS/c30-21-25-24-20(18-7-4-12-29-18)28(21)23-13-16-14-27(17-5-2-1-3-6-17)26-19(16)15-8-10-22-11-9-15/h1-14H,(H,25,30)/b23-13- |
| InChIKey | GKDLGJQKQXDCIV-QRVIBDJDSA-N |
| XLogP | 4.33 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|