C17H14N6OS — CID 8979507
4-[(Z)-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 8979507) has the molecular formula C17H14N6OS and a molecular weight of 350.41 g/mol. Its IUPAC name is 4-[(Z)-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 8979507 |
| Molecular Formula | C17H14N6OS |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-[(Z)-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1/N=C\c1cn(-c2ccccc2)nc1-c1ccco1 |
| InChI | InChI=1S/C17H14N6OS/c1-12-19-20-17(25)23(12)18-10-13-11-22(14-6-3-2-4-7-14)21-16(13)15-8-5-9-24-15/h2-11H,1H3,(H,20,25)/b18-10- |
| InChIKey | QJLOPEDYTDLWDN-ZDLGFXPLSA-N |
| XLogP | 3.58 |
| TPSA | 76.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|