C18H18N4O2 — CID 8973426
(Z)-1-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]-N-morpholin-4-ylmethanimine (PubChem CID 8973426) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is (Z)-1-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]-N-morpholin-4-ylmethanimine.
| Compound Name | (Z)-1-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]-N-morpholin-4-ylmethanimine |
|---|---|
| PubChem CID | 8973426 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (Z)-1-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]-N-morpholin-4-ylmethanimine |
| SMILES | C(=N\N1CCOCC1)\c1cn(-c2ccccc2)nc1-c1ccco1 |
| InChI | InChI=1S/C18H18N4O2/c1-2-5-16(6-3-1)22-14-15(13-19-21-8-11-23-12-9-21)18(20-22)17-7-4-10-24-17/h1-7,10,13-14H,8-9,11-12H2/b19-13- |
| InChIKey | PJVOYBVMCCAPNU-UYRXBGFRSA-N |
| XLogP | 2.80 |
| TPSA | 55.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|