C22H15N5O2S — CID 9031962
3-[(Z)-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 9031962) has the molecular formula C22H15N5O2S and a molecular weight of 413.46 g/mol. Its IUPAC name is 3-[(Z)-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[(Z)-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 9031962 |
| Molecular Formula | C22H15N5O2S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 3-[(Z)-[3-(furan-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1/N=C\c1cn(-c2ccccc2)nc1-c1ccco1 |
| InChI | InChI=1S/C22H15N5O2S/c28-21-17-9-4-5-10-18(17)24-22(30)27(21)23-13-15-14-26(16-7-2-1-3-8-16)25-20(15)19-11-6-12-29-19/h1-14H,(H,24,30)/b23-13- |
| InChIKey | UBCHLPVDIWBQSF-QRVIBDJDSA-N |
| XLogP | 4.39 |
| TPSA | 81.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|