C27H22ClNO5S — CID 94831923
[2-ethoxy-4-[(4-ethoxycarbonylphenyl)iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 94831923) has the molecular formula C27H22ClNO5S and a molecular weight of 508.00 g/mol. Its IUPAC name is [2-ethoxy-4-[(4-ethoxycarbonylphenyl)iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-ethoxy-4-[(4-ethoxycarbonylphenyl)iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 94831923 |
| Molecular Formula | C27H22ClNO5S |
| Molecular Weight | 508.00 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | [2-ethoxy-4-[(4-ethoxycarbonylphenyl)iminomethyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(/N=C/c2ccc(OC(=O)c3sc4ccccc4c3Cl)c(OCC)c2)cc1 |
| InChI | InChI=1S/C27H22ClNO5S/c1-3-32-22-15-17(16-29-19-12-10-18(11-13-19)26(30)33-4-2)9-14-21(22)34-27(31)25-24(28)20-7-5-6-8-23(20)35-25/h5-16H,3-4H2,1-2H3/b29-16+ |
| InChIKey | YZYOINAODKYGCY-MUFRIFMGSA-N |
| XLogP | 7.10 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.00 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|