C23H18ClNO5 — CID 11697520
2-[[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]methylideneamino]benzoic acid (PubChem CID 11697520) has the molecular formula C23H18ClNO5 and a molecular weight of 423.85 g/mol. Its IUPAC name is 2-[[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]methylideneamino]benzoic acid.
| Compound Name | 2-[[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 11697520 |
| Molecular Formula | C23H18ClNO5 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 2-[[4-(2-chlorobenzoyl)oxy-3-ethoxyphenyl]methylideneamino]benzoic acid |
| SMILES | CCOc1cc(/C=N/c2ccccc2C(=O)O)ccc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H18ClNO5/c1-2-29-21-13-15(14-25-19-10-6-4-8-17(19)22(26)27)11-12-20(21)30-23(28)16-7-3-5-9-18(16)24/h3-14H,2H2,1H3,(H,26,27)/b25-14+ |
| InChIKey | FTPUGODAXQSXQF-AFUMVMLFSA-N |
| XLogP | 5.41 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|