C25H18BrClN2O4S — CID 98297376
[2-[(Z)-[[(2S)-2-(2-bromophenoxy)propanoyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 98297376) has the molecular formula C25H18BrClN2O4S and a molecular weight of 557.85 g/mol. Its IUPAC name is [2-[(Z)-[[(2S)-2-(2-bromophenoxy)propanoyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(Z)-[[(2S)-2-(2-bromophenoxy)propanoyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 98297376 |
| Molecular Formula | C25H18BrClN2O4S |
| Molecular Weight | 557.85 g/mol |
| Exact Mass | 555.99 |
| IUPAC Name | [2-[(Z)-[[(2S)-2-(2-bromophenoxy)propanoyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | C[C@H](Oc1ccccc1Br)C(=O)N/N=C\c1ccccc1OC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C25H18BrClN2O4S/c1-15(32-20-12-6-4-10-18(20)26)24(30)29-28-14-16-8-2-5-11-19(16)33-25(31)23-22(27)17-9-3-7-13-21(17)34-23/h2-15H,1H3,(H,29,30)/b28-14-/t15-/m0/s1 |
| InChIKey | RSLORCAUUYGUJV-FINFLEPTSA-N |
| XLogP | 6.45 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.85 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|