C28H24BrClN2O4S — CID 6031195
[2-[(Z)-[[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 6031195) has the molecular formula C28H24BrClN2O4S and a molecular weight of 599.93 g/mol. Its IUPAC name is [2-[(Z)-[[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(Z)-[[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 6031195 |
| Molecular Formula | C28H24BrClN2O4S |
| Molecular Weight | 599.93 g/mol |
| Exact Mass | 598.03 |
| IUPAC Name | [2-[(Z)-[[2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | Cc1cc(OCC(=O)N/N=C\c2ccccc2OC(=O)c2sc3ccccc3c2Cl)c(C(C)C)cc1Br |
| InChI | InChI=1S/C28H24BrClN2O4S/c1-16(2)20-13-21(29)17(3)12-23(20)35-15-25(33)32-31-14-18-8-4-6-10-22(18)36-28(34)27-26(30)19-9-5-7-11-24(19)37-27/h4-14,16H,15H2,1-3H3,(H,32,33)/b31-14- |
| InChIKey | UCGCWXQTJLZCJD-AQLQTECXSA-N |
| XLogP | 7.50 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.93 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|