C18H17F2NO3S2 — CID 8994548
[(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl] 4-methylsulfanylbenzoate (PubChem CID 8994548) has the molecular formula C18H17F2NO3S2 and a molecular weight of 397.47 g/mol. Its IUPAC name is [(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl] 4-methylsulfanylbenzoate.
| Compound Name | [(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl] 4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8994548 |
| Molecular Formula | C18H17F2NO3S2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | [(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl] 4-methylsulfanylbenzoate |
| SMILES | CSc1ccc(C(=O)O[C@H](C)C(=O)Nc2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H17F2NO3S2/c1-11(24-17(23)12-3-7-14(25-2)8-4-12)16(22)21-13-5-9-15(10-6-13)26-18(19)20/h3-11,18H,1-2H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | MOKNMOLPULAGDQ-LLVKDONJSA-N |
| XLogP | 4.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |