C22H23N3O4S — CID 45354391
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(1,3-thiazol-4-ylmethoxy)benzoate (PubChem CID 45354391) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(1,3-thiazol-4-ylmethoxy)benzoate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(1,3-thiazol-4-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 45354391 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(1,3-thiazol-4-ylmethoxy)benzoate |
| SMILES | CC(OC(=O)c1ccc(OCc2cscn2)cc1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-15(21(26)24-17-6-8-19(9-7-17)25(2)3)29-22(27)16-4-10-20(11-5-16)28-12-18-13-30-14-23-18/h4-11,13-15H,12H2,1-3H3,(H,24,26) |
| InChIKey | NQNWFTAGCRGTFL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|