C24H30O6 — CID 7860398
[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] 3,4,5-triethoxybenzoate (PubChem CID 7860398) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is [(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] 3,4,5-triethoxybenzoate.
| Compound Name | [(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 7860398 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)O[C@@H](C)C(=O)c2ccc(C)c(C)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H30O6/c1-7-27-20-13-19(14-21(28-8-2)23(20)29-9-3)24(26)30-17(6)22(25)18-11-10-15(4)16(5)12-18/h10-14,17H,7-9H2,1-6H3/t17-/m0/s1 |
| InChIKey | SOYGAPKNEKPMGN-KRWDZBQOSA-N |
| XLogP | 4.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |