C17H22Cl2N2O3 — CID 7864798
[(2S)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate (PubChem CID 7864798) has the molecular formula C17H22Cl2N2O3 and a molecular weight of 373.28 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate.
| Compound Name | [(2S)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7864798 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [(2S)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] 2-amino-3,5-dichlorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)cc(Cl)c1N)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-10(16(22)21-9-11-5-3-2-4-6-11)24-17(23)13-7-12(18)8-14(19)15(13)20/h7-8,10-11H,2-6,9,20H2,1H3,(H,21,22)/t10-/m0/s1 |
| InChIKey | VVRNEBWJQWEQTL-JTQLQIEISA-N |
| XLogP | 3.82 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|