C21H30N4O5S — CID 16543682
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate (PubChem CID 16543682) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 16543682 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 5-(diethylsulfamoyl)-2-pyrrolidin-1-ylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCCC2)c(C(=O)OCC(=O)N(C)CCC#N)c1 |
| InChI | InChI=1S/C21H30N4O5S/c1-4-25(5-2)31(28,29)17-9-10-19(24-13-6-7-14-24)18(15-17)21(27)30-16-20(26)23(3)12-8-11-22/h9-10,15H,4-8,12-14,16H2,1-3H3 |
| InChIKey | YKWIMJMXRSZMHZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 111.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |