C19H22FNO5S — CID 16578035
(4-methoxyphenyl)methyl 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 16578035) has the molecular formula C19H22FNO5S and a molecular weight of 395.45 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 5-(diethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | (4-methoxyphenyl)methyl 5-(diethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 16578035 |
| Molecular Formula | C19H22FNO5S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (4-methoxyphenyl)methyl 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)OCc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C19H22FNO5S/c1-4-21(5-2)27(23,24)16-10-11-18(20)17(12-16)19(22)26-13-14-6-8-15(25-3)9-7-14/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | HSWGVJWWZWOFEF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |