C18H27FN2O5S — CID 8625969
[2-(2-methylbutan-2-ylamino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 8625969) has the molecular formula C18H27FN2O5S and a molecular weight of 402.49 g/mol. Its IUPAC name is [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 8625969 |
| Molecular Formula | C18H27FN2O5S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [2-(2-methylbutan-2-ylamino)-2-oxoethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)OCC(=O)NC(C)(C)CC)c1 |
| InChI | InChI=1S/C18H27FN2O5S/c1-6-18(4,5)20-16(22)12-26-17(23)14-11-13(9-10-15(14)19)27(24,25)21(7-2)8-3/h9-11H,6-8,12H2,1-5H3,(H,20,22) |
| InChIKey | WSBSTTMKIUEYDE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |